![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 10 Additional information/ | 2023-01-10 19:23 | - | |
| 09x Plan the Transformation Roadmap Exercise/ | 2023-01-10 19:23 | - | |
| 09 Plan the Transformation Roadmap/ | 2023-01-10 19:23 | - | |
| 08x Rationalize Applications Exercise/ | 2023-01-10 19:23 | - | |
| 08 Rationalize Applications/ | 2023-01-10 19:23 | - | |
| 07x Structure inventory with Portfolios Exercise/ | 2023-01-10 19:23 | - | |
| 07 Structure inventory with Portfolios/ | 2023-01-10 19:23 | - | |
| 06x Initialize Technology inventory Exercise/ | 2023-01-10 19:23 | - | |
| 06 Initialize Technology inventory/ | 2023-01-10 19:23 | - | |
| 05x Create Application inventory Exercise/ | 2023-01-10 19:23 | - | |
| 05 Create Application inventory/ | 2023-01-10 19:23 | - | |
| 04x Define scope of business change Exercise/ | 2023-01-10 19:23 | - | |
| 04 Define scope of business change/ | 2023-01-10 19:23 | - | |
| 03x Describe Value Streams Exercise/ | 2023-01-10 19:23 | - | |
| 03 Describe Value Streams/ | 2023-01-10 19:23 | - | |
| 02x Derive Business Capabilities Exercise/ | 2023-01-10 19:23 | - | |
| 02 Derive Business Capabilities/ | 2023-01-10 19:23 | - | |
| 01x Define Strategy Exercise/ | 2023-01-10 19:23 | - | |
| 01 Define strategy/ | 2023-01-10 19:23 | - | |
| 00a Introduction/ | 2023-01-10 19:23 | - | |
| 00 Table of content/ | 2023-01-10 19:23 | - | |
|
|---|