![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 05 Additional information/ | 2023-01-10 19:44 | - | |
| 04x Rationalize Applications/ | 2023-01-10 19:44 | - | |
| 04 Rationalize Applications/ | 2023-01-10 19:44 | - | |
| 03x Structure inventory with Portfolios/ | 2023-01-10 19:44 | - | |
| 03 Structure IT Asset Inventory/ | 2023-01-10 19:44 | - | |
| 02x Initialize Technology inventory/ | 2023-01-10 19:44 | - | |
| 02 Initalize Technology Inventory/ | 2023-01-10 19:44 | - | |
| 01x Create Application inventory/ | 2023-01-10 19:44 | - | |
| 01 Create Application inventory/ | 2023-01-10 19:44 | - | |
| 00a Introduction/ | 2023-01-10 19:44 | - | |
| 00 Table of content/ | 2023-01-10 19:44 | - | |
|
|---|